C20H33FO3S — CID 158851348
1-[(2S)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutan-2-yl]-4-fluorobenzene (PubChem CID 158851348) has the molecular formula C20H33FO3S and a molecular weight of 372.55 g/mol. Its IUPAC name is 1-[(2S)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutan-2-yl]-4-fluorobenzene.
| Compound Name | 1-[(2S)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutan-2-yl]-4-fluorobenzene |
|---|---|
| PubChem CID | 158851348 |
| Molecular Formula | C20H33FO3S |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1-[(2S)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutan-2-yl]-4-fluorobenzene |
| SMILES | CC(C)(C)COCCCS(=O)(=O)C[C@H](c1ccc(F)cc1)C(C)(C)C |
| InChI | InChI=1S/C20H33FO3S/c1-19(2,3)15-24-12-7-13-25(22,23)14-18(20(4,5)6)16-8-10-17(21)11-9-16/h8-11,18H,7,12-15H2,1-6H3/t18-/m1/s1 |
| InChIKey | LCGITSALUPTHIW-GOSISDBHSA-N |
| XLogP | 4.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|