C20H32O3S — CID 159619544
[1-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]cyclopentyl]benzene (PubChem CID 159619544) has the molecular formula C20H32O3S and a molecular weight of 352.54 g/mol. Its IUPAC name is [1-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]cyclopentyl]benzene.
| Compound Name | [1-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]cyclopentyl]benzene |
|---|---|
| PubChem CID | 159619544 |
| Molecular Formula | C20H32O3S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | [1-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]cyclopentyl]benzene |
| SMILES | CC(C)(C)COCCCS(=O)(=O)CC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C20H32O3S/c1-19(2,3)16-23-14-9-15-24(21,22)17-20(12-7-8-13-20)18-10-5-4-6-11-18/h4-6,10-11H,7-9,12-17H2,1-3H3 |
| InChIKey | VSKRTSQERCTEOC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|