C10H13NO2S — CID 112639905
(1-phenylcyclopropyl)methanesulfonamide (PubChem CID 112639905) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is (1-phenylcyclopropyl)methanesulfonamide.
| Compound Name | (1-phenylcyclopropyl)methanesulfonamide |
|---|---|
| PubChem CID | 112639905 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | (1-phenylcyclopropyl)methanesulfonamide |
| SMILES | NS(=O)(=O)CC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C10H13NO2S/c11-14(12,13)8-10(6-7-10)9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,11,12,13) |
| InChIKey | ZQNBCRXZEOXZDM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |