C20H35NO3S — CID 146353301
N-benzyl-3-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)propane-1-sulfonamide (PubChem CID 146353301) has the molecular formula C20H35NO3S and a molecular weight of 369.57 g/mol. Its IUPAC name is N-benzyl-3-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)propane-1-sulfonamide.
| Compound Name | N-benzyl-3-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 146353301 |
| Molecular Formula | C20H35NO3S |
| Molecular Weight | 369.57 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N-benzyl-3-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)propane-1-sulfonamide |
| SMILES | CC(C)(C)COCCCS(=O)(=O)N(Cc1ccccc1)CC(C)(C)C |
| InChI | InChI=1S/C20H35NO3S/c1-19(2,3)16-21(15-18-11-8-7-9-12-18)25(22,23)14-10-13-24-17-20(4,5)6/h7-9,11-12H,10,13-17H2,1-6H3 |
| InChIKey | DOHYAXXYJUMVQY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|