C12H14F3NO4S — CID 60948432
3-[benzyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid (PubChem CID 60948432) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is 3-[benzyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[benzyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 60948432 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-[benzyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)N(Cc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO4S/c13-12(14,15)9-16(8-10-4-2-1-3-5-10)21(19,20)7-6-11(17)18/h1-5H,6-9H2,(H,17,18) |
| InChIKey | HITLDPGMLMAUSU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |