3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid

C8H14F3NO4S — CID 60952154

IUPAC3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid
SMILESCCCN(CC(F)(F)F)S(=O)(=O)CCC(=O)O
InChIInChI=1S/C8H14F3NO4S/c1-2-4-12(6-8(9,10)11)17(15,16)5-3-7(13)14/h2-6H2,1H3,(H,13,14)
InChIKeyDAAOLBPOJIDRFY-UHFFFAOYSA-N
MW277.26 g/mol
LogP1.07
Rot. Bonds7

About 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid

3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid (PubChem CID 60952154) has the molecular formula C8H14F3NO4S and a molecular weight of 277.26 g/mol. Its IUPAC name is 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid.

Molecular Properties

Compound Name3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid
PubChem CID60952154
Molecular FormulaC8H14F3NO4S
Molecular Weight277.26 g/mol
Exact Mass277.06
IUPAC Name3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid
SMILESCCCN(CC(F)(F)F)S(=O)(=O)CCC(=O)O
InChIInChI=1S/C8H14F3NO4S/c1-2-4-12(6-8(9,10)11)17(15,16)5-3-7(13)14/h2-6H2,1H3,(H,13,14)
InChIKeyDAAOLBPOJIDRFY-UHFFFAOYSA-N
XLogP1.07
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.26
LogP ≤ 51.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid?
The IUPAC name of 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid (CID 60952154) is 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid.
What is the SMILES notation for 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid?
The canonical SMILES for 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid is CCCN(CC(F)(F)F)S(=O)(=O)CCC(=O)O.
What is the InChIKey of 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid?
The InChIKey is DAAOLBPOJIDRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO4S/c1-2-4-12(6-8(9,10)11)17(15,16)5-3-7(13)14/h2-6H2,1H3,(H,13,14).
What are the key properties of 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid?
3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid has a molecular weight of 277.26 g/mol, XLogP of 1.07, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[propyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid is sourced from PubChem (CID 60952154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).