C6H11F3N2O4S — CID 79258153
2-[dimethylsulfamoyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79258153) has the molecular formula C6H11F3N2O4S and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-[dimethylsulfamoyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[dimethylsulfamoyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79258153 |
| Molecular Formula | C6H11F3N2O4S |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-[dimethylsulfamoyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O4S/c1-10(2)16(14,15)11(3-5(12)13)4-6(7,8)9/h3-4H2,1-2H3,(H,12,13) |
| InChIKey | WNZAAEHXGPEKEV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |