C5H9F3N2O4S — CID 114806576
2-[methylsulfamoyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 114806576) has the molecular formula C5H9F3N2O4S and a molecular weight of 250.20 g/mol. Its IUPAC name is 2-[methylsulfamoyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[methylsulfamoyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 114806576 |
| Molecular Formula | C5H9F3N2O4S |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-[methylsulfamoyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CNS(=O)(=O)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C5H9F3N2O4S/c1-9-15(13,14)10(2-4(11)12)3-5(6,7)8/h9H,2-3H2,1H3,(H,11,12) |
| InChIKey | RUBPMIKNHYKYOX-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |