C7H12F3NO4S — CID 63066774
2-[2-methylpropyl(trifluoromethylsulfonyl)amino]acetic acid (PubChem CID 63066774) has the molecular formula C7H12F3NO4S and a molecular weight of 263.24 g/mol. Its IUPAC name is 2-[2-methylpropyl(trifluoromethylsulfonyl)amino]acetic acid.
| Compound Name | 2-[2-methylpropyl(trifluoromethylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 63066774 |
| Molecular Formula | C7H12F3NO4S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-[2-methylpropyl(trifluoromethylsulfonyl)amino]acetic acid |
| SMILES | CC(C)CN(CC(=O)O)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO4S/c1-5(2)3-11(4-6(12)13)16(14,15)7(8,9)10/h5H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | NURYKXXTIQGPPC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |