C8H16N2O6S — CID 55245356
2-[carboxymethyl-[methyl(propan-2-yl)sulfamoyl]amino]acetic acid (PubChem CID 55245356) has the molecular formula C8H16N2O6S and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-[carboxymethyl-[methyl(propan-2-yl)sulfamoyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[methyl(propan-2-yl)sulfamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 55245356 |
| Molecular Formula | C8H16N2O6S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-[carboxymethyl-[methyl(propan-2-yl)sulfamoyl]amino]acetic acid |
| SMILES | CC(C)N(C)S(=O)(=O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C8H16N2O6S/c1-6(2)9(3)17(15,16)10(4-7(11)12)5-8(13)14/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | TYIBBMDHPROHED-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |