C6H13N3O5S — CID 107435768
2-[(2-amino-2-oxoethyl)-(dimethylsulfamoyl)amino]acetic acid (PubChem CID 107435768) has the molecular formula C6H13N3O5S and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(dimethylsulfamoyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(dimethylsulfamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 107435768 |
| Molecular Formula | C6H13N3O5S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(dimethylsulfamoyl)amino]acetic acid |
| SMILES | CN(C)S(=O)(=O)N(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C6H13N3O5S/c1-8(2)15(13,14)9(3-5(7)10)4-6(11)12/h3-4H2,1-2H3,(H2,7,10)(H,11,12) |
| InChIKey | FOSXBNBTMHYXTA-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |