C7H14N2O5S — CID 103101578
3-[(2-amino-2-oxoethyl)-ethylsulfamoyl]propanoic acid (PubChem CID 103101578) has the molecular formula C7H14N2O5S and a molecular weight of 238.26 g/mol. Its IUPAC name is 3-[(2-amino-2-oxoethyl)-ethylsulfamoyl]propanoic acid.
| Compound Name | 3-[(2-amino-2-oxoethyl)-ethylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 103101578 |
| Molecular Formula | C7H14N2O5S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 3-[(2-amino-2-oxoethyl)-ethylsulfamoyl]propanoic acid |
| SMILES | CCN(CC(N)=O)S(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C7H14N2O5S/c1-2-9(5-6(8)10)15(13,14)4-3-7(11)12/h2-5H2,1H3,(H2,8,10)(H,11,12) |
| InChIKey | IYPOWGAAYNEQOD-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |