C13H28N2O4S — CID 60950529
3-[2-(diethylamino)ethyl-(2-methylpropyl)sulfamoyl]propanoic acid (PubChem CID 60950529) has the molecular formula C13H28N2O4S and a molecular weight of 308.44 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethyl-(2-methylpropyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[2-(diethylamino)ethyl-(2-methylpropyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 60950529 |
| Molecular Formula | C13H28N2O4S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3-[2-(diethylamino)ethyl-(2-methylpropyl)sulfamoyl]propanoic acid |
| SMILES | CCN(CC)CCN(CC(C)C)S(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C13H28N2O4S/c1-5-14(6-2)8-9-15(11-12(3)4)20(18,19)10-7-13(16)17/h12H,5-11H2,1-4H3,(H,16,17) |
| InChIKey | BMXLLDDHIROFEH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |