C9H16N2O4S — CID 60950576
3-[2-cyanopropyl(ethyl)sulfamoyl]propanoic acid (PubChem CID 60950576) has the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. Its IUPAC name is 3-[2-cyanopropyl(ethyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[2-cyanopropyl(ethyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 60950576 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-[2-cyanopropyl(ethyl)sulfamoyl]propanoic acid |
| SMILES | CCN(CC(C)C#N)S(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C9H16N2O4S/c1-3-11(7-8(2)6-10)16(14,15)5-4-9(12)13/h8H,3-5,7H2,1-2H3,(H,12,13) |
| InChIKey | KEUFTOJNRKIENI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |