C11H14N2O4S2 — CID 61384905
4-[2-cyanopropyl(ethyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 61384905) has the molecular formula C11H14N2O4S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-[2-cyanopropyl(ethyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[2-cyanopropyl(ethyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61384905 |
| Molecular Formula | C11H14N2O4S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 4-[2-cyanopropyl(ethyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CCN(CC(C)C#N)S(=O)(=O)c1csc(C(=O)O)c1 |
| InChI | InChI=1S/C11H14N2O4S2/c1-3-13(6-8(2)5-12)19(16,17)9-4-10(11(14)15)18-7-9/h4,7-8H,3,6H2,1-2H3,(H,14,15) |
| InChIKey | TYSXRFKECBUIRL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |