C10H15NO5S2 — CID 63617805
4-[2-hydroxyethyl(propyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 63617805) has the molecular formula C10H15NO5S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(propyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[2-hydroxyethyl(propyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63617805 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 4-[2-hydroxyethyl(propyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CCCN(CCO)S(=O)(=O)c1csc(C(=O)O)c1 |
| InChI | InChI=1S/C10H15NO5S2/c1-2-3-11(4-5-12)18(15,16)8-6-9(10(13)14)17-7-8/h6-7,12H,2-5H2,1H3,(H,13,14) |
| InChIKey | FRELUFDIYGQWKW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |