C12H19NO4S2 — CID 61074403
4-[2-methylpropyl(propan-2-yl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 61074403) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-[2-methylpropyl(propan-2-yl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[2-methylpropyl(propan-2-yl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61074403 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-[2-methylpropyl(propan-2-yl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CC(C)CN(C(C)C)S(=O)(=O)c1csc(C(=O)O)c1 |
| InChI | InChI=1S/C12H19NO4S2/c1-8(2)6-13(9(3)4)19(16,17)10-5-11(12(14)15)18-7-10/h5,7-9H,6H2,1-4H3,(H,14,15) |
| InChIKey | RZOYUOQYMATNBM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |