C6H11N3O3S — CID 103102496
2-[cyanomethylsulfonyl(ethyl)amino]acetamide (PubChem CID 103102496) has the molecular formula C6H11N3O3S and a molecular weight of 205.24 g/mol. Its IUPAC name is 2-[cyanomethylsulfonyl(ethyl)amino]acetamide.
| Compound Name | 2-[cyanomethylsulfonyl(ethyl)amino]acetamide |
|---|---|
| PubChem CID | 103102496 |
| Molecular Formula | C6H11N3O3S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 2-[cyanomethylsulfonyl(ethyl)amino]acetamide |
| SMILES | CCN(CC(N)=O)S(=O)(=O)CC#N |
| InChI | InChI=1S/C6H11N3O3S/c1-2-9(5-6(8)10)13(11,12)4-3-7/h2,4-5H2,1H3,(H2,8,10) |
| InChIKey | PWJORYPDJSAHKL-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |