C12H19N3O3S — CID 103101696
2-[[2-(aminomethyl)phenyl]methylsulfonyl-ethylamino]acetamide (PubChem CID 103101696) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)phenyl]methylsulfonyl-ethylamino]acetamide.
| Compound Name | 2-[[2-(aminomethyl)phenyl]methylsulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 103101696 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[[2-(aminomethyl)phenyl]methylsulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)S(=O)(=O)Cc1ccccc1CN |
| InChI | InChI=1S/C12H19N3O3S/c1-2-15(8-12(14)16)19(17,18)9-11-6-4-3-5-10(11)7-13/h3-6H,2,7-9,13H2,1H3,(H2,14,16) |
| InChIKey | GTJMRDZOXPXBEN-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |