About 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide
2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide (PubChem CID 15118457) has the molecular formula C12H13Cl2F3N2O3S
and a molecular weight of 393.21 g/mol. Its IUPAC name is 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide.
Molecular Properties
| Compound Name | 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide |
| PubChem CID | 15118457 |
| Molecular Formula | C12H13Cl2F3N2O3S |
| Molecular Weight | 393.21 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)S(=O)(=O)Cc1cc(C(F)(F)F)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H13Cl2F3N2O3S/c1-2-19(5-10(18)20)23(21,22)6-7-3-8(12(15,16)17)4-9(13)11(7)14/h3-4H,2,5-6H2,1H3,(H2,18,20) |
| InChIKey | BOTQBNUVNGWSAF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide?
The IUPAC name of 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide (CID 15118457) is 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide.
What is the SMILES notation for 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide?
The canonical SMILES for 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide is CCN(CC(N)=O)S(=O)(=O)Cc1cc(C(F)(F)F)cc(Cl)c1Cl.
What is the InChIKey of 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide?
The InChIKey is BOTQBNUVNGWSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2F3N2O3S/c1-2-19(5-10(18)20)23(21,22)6-7-3-8(12(15,16)17)4-9(13)11(7)14/h3-4H,2,5-6H2,1H3,(H2,18,20).
What are the key properties of 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide?
2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide has a molecular weight of 393.21 g/mol, XLogP of 2.65, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,3-dichloro-5-(trifluoromethyl)phenyl]methylsulfonyl-ethylamino]acetamide is sourced from PubChem (CID 15118457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).