C11H17N3O3S — CID 103101685
2-[[4-(aminomethyl)phenyl]sulfonyl-ethylamino]acetamide (PubChem CID 103101685) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)phenyl]sulfonyl-ethylamino]acetamide.
| Compound Name | 2-[[4-(aminomethyl)phenyl]sulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 103101685 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-[[4-(aminomethyl)phenyl]sulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)S(=O)(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C11H17N3O3S/c1-2-14(8-11(13)15)18(16,17)10-5-3-9(7-12)4-6-10/h3-6H,2,7-8,12H2,1H3,(H2,13,15) |
| InChIKey | WDEOOPKAQUVEFO-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |