C12H18N4O4S — CID 62923333
2-[[4-(1-aminoethyl)phenyl]sulfonyl-(2-amino-2-oxoethyl)amino]acetamide (PubChem CID 62923333) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-[[4-(1-aminoethyl)phenyl]sulfonyl-(2-amino-2-oxoethyl)amino]acetamide.
| Compound Name | 2-[[4-(1-aminoethyl)phenyl]sulfonyl-(2-amino-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 62923333 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-[[4-(1-aminoethyl)phenyl]sulfonyl-(2-amino-2-oxoethyl)amino]acetamide |
| SMILES | CC(N)c1ccc(S(=O)(=O)N(CC(N)=O)CC(N)=O)cc1 |
| InChI | InChI=1S/C12H18N4O4S/c1-8(13)9-2-4-10(5-3-9)21(19,20)16(6-11(14)17)7-12(15)18/h2-5,8H,6-7,13H2,1H3,(H2,14,17)(H2,15,18) |
| InChIKey | QZCATTOBPWTXFR-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |