C12H17N3O5S — CID 62923168
2-[(2-amino-2-oxoethyl)-[4-(1-hydroxyethyl)phenyl]sulfonylamino]acetamide (PubChem CID 62923168) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[4-(1-hydroxyethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[4-(1-hydroxyethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 62923168 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[4-(1-hydroxyethyl)phenyl]sulfonylamino]acetamide |
| SMILES | CC(O)c1ccc(S(=O)(=O)N(CC(N)=O)CC(N)=O)cc1 |
| InChI | InChI=1S/C12H17N3O5S/c1-8(16)9-2-4-10(5-3-9)21(19,20)15(6-11(13)17)7-12(14)18/h2-5,8,16H,6-7H2,1H3,(H2,13,17)(H2,14,18) |
| InChIKey | BHULKAPQFAHQAN-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |