C12H16N2O6S — CID 103101553
5-[(2-amino-2-oxoethyl)-ethylsulfamoyl]-2-methoxybenzoic acid (PubChem CID 103101553) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is 5-[(2-amino-2-oxoethyl)-ethylsulfamoyl]-2-methoxybenzoic acid.
| Compound Name | 5-[(2-amino-2-oxoethyl)-ethylsulfamoyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 103101553 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 5-[(2-amino-2-oxoethyl)-ethylsulfamoyl]-2-methoxybenzoic acid |
| SMILES | CCN(CC(N)=O)S(=O)(=O)c1ccc(OC)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H16N2O6S/c1-3-14(7-11(13)15)21(18,19)8-4-5-10(20-2)9(6-8)12(16)17/h4-6H,3,7H2,1-2H3,(H2,13,15)(H,16,17) |
| InChIKey | KCLHFVAVYCUXKH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |