C11H15N3O5S — CID 103100991
5-amino-2-[(2-amino-2-oxoethyl)-ethylsulfamoyl]benzoic acid (PubChem CID 103100991) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is 5-amino-2-[(2-amino-2-oxoethyl)-ethylsulfamoyl]benzoic acid.
| Compound Name | 5-amino-2-[(2-amino-2-oxoethyl)-ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 103100991 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-amino-2-[(2-amino-2-oxoethyl)-ethylsulfamoyl]benzoic acid |
| SMILES | CCN(CC(N)=O)S(=O)(=O)c1ccc(N)cc1C(=O)O |
| InChI | InChI=1S/C11H15N3O5S/c1-2-14(6-10(13)15)20(18,19)9-4-3-7(12)5-8(9)11(16)17/h3-5H,2,6,12H2,1H3,(H2,13,15)(H,16,17) |
| InChIKey | LCIFHADPNGDMQK-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|