C10H14ClN3O3S — CID 103100989
2-[(2-amino-4-chlorophenyl)sulfonyl-ethylamino]acetamide (PubChem CID 103100989) has the molecular formula C10H14ClN3O3S and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-[(2-amino-4-chlorophenyl)sulfonyl-ethylamino]acetamide.
| Compound Name | 2-[(2-amino-4-chlorophenyl)sulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 103100989 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-[(2-amino-4-chlorophenyl)sulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)S(=O)(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C10H14ClN3O3S/c1-2-14(6-10(13)15)18(16,17)9-4-3-7(11)5-8(9)12/h3-5H,2,6,12H2,1H3,(H2,13,15) |
| InChIKey | URPTXOJMQIAPBT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|