C11H18N2O2S — CID 16783834
2-(aminomethyl)-N,N-diethylbenzenesulfonamide (PubChem CID 16783834) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-diethylbenzenesulfonamide.
| Compound Name | 2-(aminomethyl)-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 16783834 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(aminomethyl)-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccccc1CN |
| InChI | InChI=1S/C11H18N2O2S/c1-3-13(4-2)16(14,15)11-8-6-5-7-10(11)9-12/h5-8H,3-4,9,12H2,1-2H3 |
| InChIKey | GCHQJHDQQRFUGM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |