C10H20N2O5S — CID 60948376
4-[ethyl-[2-(ethylamino)-2-oxoethyl]sulfamoyl]butanoic acid (PubChem CID 60948376) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-[ethyl-[2-(ethylamino)-2-oxoethyl]sulfamoyl]butanoic acid.
| Compound Name | 4-[ethyl-[2-(ethylamino)-2-oxoethyl]sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 60948376 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-[ethyl-[2-(ethylamino)-2-oxoethyl]sulfamoyl]butanoic acid |
| SMILES | CCNC(=O)CN(CC)S(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C10H20N2O5S/c1-3-11-9(13)8-12(4-2)18(16,17)7-5-6-10(14)15/h3-8H2,1-2H3,(H,11,13)(H,14,15) |
| InChIKey | PTVMXTCGPJLABN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |