C14H21NO4S — CID 43588369
4-[ethyl-[(2-methylphenyl)methyl]sulfamoyl]butanoic acid (PubChem CID 43588369) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-[ethyl-[(2-methylphenyl)methyl]sulfamoyl]butanoic acid.
| Compound Name | 4-[ethyl-[(2-methylphenyl)methyl]sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 43588369 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-[ethyl-[(2-methylphenyl)methyl]sulfamoyl]butanoic acid |
| SMILES | CCN(Cc1ccccc1C)S(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C14H21NO4S/c1-3-15(11-13-8-5-4-7-12(13)2)20(18,19)10-6-9-14(16)17/h4-5,7-8H,3,6,9-11H2,1-2H3,(H,16,17) |
| InChIKey | FRWOKTNUYVJNIO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |