C11H16BrNO4S2 — CID 54875088
4-[(5-bromothiophen-2-yl)methyl-ethylsulfamoyl]butanoic acid (PubChem CID 54875088) has the molecular formula C11H16BrNO4S2 and a molecular weight of 370.29 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)methyl-ethylsulfamoyl]butanoic acid.
| Compound Name | 4-[(5-bromothiophen-2-yl)methyl-ethylsulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 54875088 |
| Molecular Formula | C11H16BrNO4S2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)methyl-ethylsulfamoyl]butanoic acid |
| SMILES | CCN(Cc1ccc(Br)s1)S(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C11H16BrNO4S2/c1-2-13(8-9-5-6-10(12)18-9)19(16,17)7-3-4-11(14)15/h5-6H,2-4,7-8H2,1H3,(H,14,15) |
| InChIKey | LAXCWNGGVGHGJQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |