C10H12BrNO3S — CID 61011624
5-[(5-bromothiophen-2-yl)methylamino]-5-oxopentanoic acid (PubChem CID 61011624) has the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. Its IUPAC name is 5-[(5-bromothiophen-2-yl)methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(5-bromothiophen-2-yl)methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61011624 |
| Molecular Formula | C10H12BrNO3S |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 5-[(5-bromothiophen-2-yl)methylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C10H12BrNO3S/c11-8-5-4-7(16-8)6-12-9(13)2-1-3-10(14)15/h4-5H,1-3,6H2,(H,12,13)(H,14,15) |
| InChIKey | BIXBRVKRDRQUFM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |