C9H13Cl2NO2S2 — CID 107650976
2-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylethanesulfonamide (PubChem CID 107650976) has the molecular formula C9H13Cl2NO2S2 and a molecular weight of 302.25 g/mol. Its IUPAC name is 2-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylethanesulfonamide.
| Compound Name | 2-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 107650976 |
| Molecular Formula | C9H13Cl2NO2S2 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 2-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylethanesulfonamide |
| SMILES | CCN(Cc1ccc(Cl)s1)S(=O)(=O)CCCl |
| InChI | InChI=1S/C9H13Cl2NO2S2/c1-2-12(16(13,14)6-5-10)7-8-3-4-9(11)15-8/h3-4H,2,5-7H2,1H3 |
| InChIKey | CYTSEZXKSDKENG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|