C15H17ClFNO2S2 — CID 86808037
N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-1-(4-fluoro-2-methylphenyl)methanesulfonamide (PubChem CID 86808037) has the molecular formula C15H17ClFNO2S2 and a molecular weight of 361.89 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-1-(4-fluoro-2-methylphenyl)methanesulfonamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-1-(4-fluoro-2-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 86808037 |
| Molecular Formula | C15H17ClFNO2S2 |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-1-(4-fluoro-2-methylphenyl)methanesulfonamide |
| SMILES | CCN(Cc1ccc(Cl)s1)S(=O)(=O)Cc1ccc(F)cc1C |
| InChI | InChI=1S/C15H17ClFNO2S2/c1-3-18(9-14-6-7-15(16)21-14)22(19,20)10-12-4-5-13(17)8-11(12)2/h4-8H,3,9-10H2,1-2H3 |
| InChIKey | SMWUIRAMBUURPY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |