C14H18FNO4S — CID 167969467
2-[cyclopropylmethyl-[(4-fluoro-2-methylphenyl)methylsulfonyl]amino]acetic acid (PubChem CID 167969467) has the molecular formula C14H18FNO4S and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[(4-fluoro-2-methylphenyl)methylsulfonyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[(4-fluoro-2-methylphenyl)methylsulfonyl]amino]acetic acid |
|---|---|
| PubChem CID | 167969467 |
| Molecular Formula | C14H18FNO4S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[cyclopropylmethyl-[(4-fluoro-2-methylphenyl)methylsulfonyl]amino]acetic acid |
| SMILES | Cc1cc(F)ccc1CS(=O)(=O)N(CC(=O)O)CC1CC1 |
| InChI | InChI=1S/C14H18FNO4S/c1-10-6-13(15)5-4-12(10)9-21(19,20)16(8-14(17)18)7-11-2-3-11/h4-6,11H,2-3,7-9H2,1H3,(H,17,18) |
| InChIKey | FBSNHLUOXJREKO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |