C16H21FO — CID 114347257
1-(3-ethylcyclopentyl)-2-(4-fluoro-2-methylphenyl)ethanone (PubChem CID 114347257) has the molecular formula C16H21FO and a molecular weight of 248.34 g/mol. Its IUPAC name is 1-(3-ethylcyclopentyl)-2-(4-fluoro-2-methylphenyl)ethanone.
| Compound Name | 1-(3-ethylcyclopentyl)-2-(4-fluoro-2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 114347257 |
| Molecular Formula | C16H21FO |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-(3-ethylcyclopentyl)-2-(4-fluoro-2-methylphenyl)ethanone |
| SMILES | CCC1CCC(C(=O)Cc2ccc(F)cc2C)C1 |
| InChI | InChI=1S/C16H21FO/c1-3-12-4-5-14(9-12)16(18)10-13-6-7-15(17)8-11(13)2/h6-8,12,14H,3-5,9-10H2,1-2H3 |
| InChIKey | WPCOYDYJZIPTKL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |