C16H20F2O — CID 64740615
2-(2,4-difluorophenyl)-1-(3,4-dimethylcyclohexyl)ethanone (PubChem CID 64740615) has the molecular formula C16H20F2O and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(3,4-dimethylcyclohexyl)ethanone.
| Compound Name | 2-(2,4-difluorophenyl)-1-(3,4-dimethylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 64740615 |
| Molecular Formula | C16H20F2O |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(3,4-dimethylcyclohexyl)ethanone |
| SMILES | CC1CCC(C(=O)Cc2ccc(F)cc2F)CC1C |
| InChI | InChI=1S/C16H20F2O/c1-10-3-4-13(7-11(10)2)16(19)8-12-5-6-14(17)9-15(12)18/h5-6,9-11,13H,3-4,7-8H2,1-2H3 |
| InChIKey | JCWMHXJVEZBZLR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |