C15H19F2NO — CID 110488908
2-(2,4-difluorophenyl)-N-(2-methylcyclohexyl)acetamide (PubChem CID 110488908) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-(2,4-difluorophenyl)-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 110488908 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N-(2-methylcyclohexyl)acetamide |
| SMILES | CC1CCCCC1NC(=O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H19F2NO/c1-10-4-2-3-5-14(10)18-15(19)8-11-6-7-12(16)9-13(11)17/h6-7,9-10,14H,2-5,8H2,1H3,(H,18,19) |
| InChIKey | ZEFHKSLPAIYQIL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |