C14H18F2N2O — CID 124517357
2-(2,4-difluorophenyl)-N-[(2R,3R)-2-methylpiperidin-3-yl]acetamide (PubChem CID 124517357) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N-[(2R,3R)-2-methylpiperidin-3-yl]acetamide.
| Compound Name | 2-(2,4-difluorophenyl)-N-[(2R,3R)-2-methylpiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 124517357 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N-[(2R,3R)-2-methylpiperidin-3-yl]acetamide |
| SMILES | C[C@H]1NCCC[C@H]1NC(=O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C14H18F2N2O/c1-9-13(3-2-6-17-9)18-14(19)7-10-4-5-11(15)8-12(10)16/h4-5,8-9,13,17H,2-3,6-7H2,1H3,(H,18,19)/t9-,13-/m1/s1 |
| InChIKey | FNGZTJNRLRFTOO-NOZJJQNGSA-N |
| XLogP | 1.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |