C17H23F2N3O2 — CID 120576940
3-acetamido-3-(2,4-difluorophenyl)-N-(2-methylpiperidin-3-yl)propanamide (PubChem CID 120576940) has the molecular formula C17H23F2N3O2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-acetamido-3-(2,4-difluorophenyl)-N-(2-methylpiperidin-3-yl)propanamide.
| Compound Name | 3-acetamido-3-(2,4-difluorophenyl)-N-(2-methylpiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 120576940 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 3-acetamido-3-(2,4-difluorophenyl)-N-(2-methylpiperidin-3-yl)propanamide |
| SMILES | CC(=O)NC(CC(=O)NC1CCCNC1C)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H23F2N3O2/c1-10-15(4-3-7-20-10)22-17(24)9-16(21-11(2)23)13-6-5-12(18)8-14(13)19/h5-6,8,10,15-16,20H,3-4,7,9H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | LDRJYHDOJDZIQH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |