C18H27N3O2 — CID 120576079
3-acetamido-3-(4-methylphenyl)-N-(2-methylpiperidin-3-yl)propanamide (PubChem CID 120576079) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-acetamido-3-(4-methylphenyl)-N-(2-methylpiperidin-3-yl)propanamide.
| Compound Name | 3-acetamido-3-(4-methylphenyl)-N-(2-methylpiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 120576079 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 3-acetamido-3-(4-methylphenyl)-N-(2-methylpiperidin-3-yl)propanamide |
| SMILES | CC(=O)NC(CC(=O)NC1CCCNC1C)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H27N3O2/c1-12-6-8-15(9-7-12)17(20-14(3)22)11-18(23)21-16-5-4-10-19-13(16)2/h6-9,13,16-17,19H,4-5,10-11H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | HCSCZIALWQZQST-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |