C15H22BrClN2O2 — CID 120577760
2-(5-bromo-2-methoxyphenyl)-N-(2-methylpiperidin-3-yl)acetamide;hydrochloride (PubChem CID 120577760) has the molecular formula C15H22BrClN2O2 and a molecular weight of 377.71 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-N-(2-methylpiperidin-3-yl)acetamide;hydrochloride.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-N-(2-methylpiperidin-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120577760 |
| Molecular Formula | C15H22BrClN2O2 |
| Molecular Weight | 377.71 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-N-(2-methylpiperidin-3-yl)acetamide;hydrochloride |
| SMILES | COc1ccc(Br)cc1CC(=O)NC1CCCNC1C.Cl |
| InChI | InChI=1S/C15H21BrN2O2.ClH/c1-10-13(4-3-7-17-10)18-15(19)9-11-8-12(16)5-6-14(11)20-2;/h5-6,8,10,13,17H,3-4,7,9H2,1-2H3,(H,18,19);1H |
| InChIKey | XQCXCMXQRWJLJF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.71 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |