C13H16BrNO2 — CID 116547520
2-(5-bromo-2-methoxyphenyl)-1-pyrrolidin-2-ylethanone (PubChem CID 116547520) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-1-pyrrolidin-2-ylethanone.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-1-pyrrolidin-2-ylethanone |
|---|---|
| PubChem CID | 116547520 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-1-pyrrolidin-2-ylethanone |
| SMILES | COc1ccc(Br)cc1CC(=O)C1CCCN1 |
| InChI | InChI=1S/C13H16BrNO2/c1-17-13-5-4-10(14)7-9(13)8-12(16)11-3-2-6-15-11/h4-5,7,11,15H,2-3,6,8H2,1H3 |
| InChIKey | MGHJNJSWEPZFSJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |