C13H16ClNO2 — CID 82088330
2-(3-chloro-4-methoxyphenyl)-1-pyrrolidin-2-ylethanone (PubChem CID 82088330) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-1-pyrrolidin-2-ylethanone.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-1-pyrrolidin-2-ylethanone |
|---|---|
| PubChem CID | 82088330 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-1-pyrrolidin-2-ylethanone |
| SMILES | COc1ccc(CC(=O)C2CCCN2)cc1Cl |
| InChI | InChI=1S/C13H16ClNO2/c1-17-13-5-4-9(7-10(13)14)8-12(16)11-3-2-6-15-11/h4-5,7,11,15H,2-3,6,8H2,1H3 |
| InChIKey | SYRGNQPKVVKMCE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |