C14H20BrClN2O2 — CID 119387893
2-(5-bromo-2-methoxyphenyl)-N-piperidin-4-ylacetamide;hydrochloride (PubChem CID 119387893) has the molecular formula C14H20BrClN2O2 and a molecular weight of 363.68 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-N-piperidin-4-ylacetamide;hydrochloride.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-N-piperidin-4-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119387893 |
| Molecular Formula | C14H20BrClN2O2 |
| Molecular Weight | 363.68 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-N-piperidin-4-ylacetamide;hydrochloride |
| SMILES | COc1ccc(Br)cc1CC(=O)NC1CCNCC1.Cl |
| InChI | InChI=1S/C14H19BrN2O2.ClH/c1-19-13-3-2-11(15)8-10(13)9-14(18)17-12-4-6-16-7-5-12;/h2-3,8,12,16H,4-7,9H2,1H3,(H,17,18);1H |
| InChIKey | SDQNZULPRTULRX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.68 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |