C8H6F9NO6S — CID 165363438
2-[carboxymethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetic acid (PubChem CID 165363438) has the molecular formula C8H6F9NO6S and a molecular weight of 415.19 g/mol. Its IUPAC name is 2-[carboxymethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetic acid.
| Compound Name | 2-[carboxymethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 165363438 |
| Molecular Formula | C8H6F9NO6S |
| Molecular Weight | 415.19 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | 2-[carboxymethyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F9NO6S/c9-5(10,7(13,14)15)6(11,12)8(16,17)25(23,24)18(1-3(19)20)2-4(21)22/h1-2H2,(H,19,20)(H,21,22) |
| InChIKey | PQKKESZYSLDJMD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|