C20H22F21N2O7S2+ — CID 163324006
3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfonyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 163324006) has the molecular formula C20H22F21N2O7S2+ and a molecular weight of 865.49 g/mol. Its IUPAC name is 3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfonyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfonyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 163324006 |
| Molecular Formula | C20H22F21N2O7S2+ |
| Molecular Weight | 865.49 g/mol |
| Exact Mass | 865.05 |
| IUPAC Name | 3-[carboxymethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfonyl)amino]propyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCN(CC(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C20H21F21N2O7S2/c1-43(2,7-4-8-51(46,47)48)6-3-5-42(9-10(44)45)52(49,50)20(40,41)18(35,36)16(31,32)14(27,28)12(23,24)11(21,22)13(25,26)15(29,30)17(33,34)19(37,38)39/h3-9H2,1-2H3,(H-,44,45,46,47,48)/p+1 |
| InChIKey | DFXZKRDSDJBERC-UHFFFAOYSA-O |
| XLogP | 5.68 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|