C8H3F14NO4S — CID 18362320
2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(1,1,2,2,2-pentafluoroethyl)amino]acetic acid (PubChem CID 18362320) has the molecular formula C8H3F14NO4S and a molecular weight of 475.15 g/mol. Its IUPAC name is 2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(1,1,2,2,2-pentafluoroethyl)amino]acetic acid.
| Compound Name | 2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(1,1,2,2,2-pentafluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 18362320 |
| Molecular Formula | C8H3F14NO4S |
| Molecular Weight | 475.15 g/mol |
| Exact Mass | 474.96 |
| IUPAC Name | 2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(1,1,2,2,2-pentafluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H3F14NO4S/c9-3(10,5(13,14)15)4(11,12)8(21,22)28(26,27)23(1-2(24)25)7(19,20)6(16,17)18/h1H2,(H,24,25) |
| InChIKey | LWLGBZRAGFKTLH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|