C12H8F17NO4S — CID 88713561
2-[ethylsulfonyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)amino]acetic acid (PubChem CID 88713561) has the molecular formula C12H8F17NO4S and a molecular weight of 585.23 g/mol. Its IUPAC name is 2-[ethylsulfonyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)amino]acetic acid.
| Compound Name | 2-[ethylsulfonyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)amino]acetic acid |
|---|---|
| PubChem CID | 88713561 |
| Molecular Formula | C12H8F17NO4S |
| Molecular Weight | 585.23 g/mol |
| Exact Mass | 584.99 |
| IUPAC Name | 2-[ethylsulfonyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)amino]acetic acid |
| SMILES | CCS(=O)(=O)N(CC(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F17NO4S/c1-2-35(33,34)30(3-4(31)32)12(28,29)10(23,24)8(19,20)6(15,16)5(13,14)7(17,18)9(21,22)11(25,26)27/h2-3H2,1H3,(H,31,32) |
| InChIKey | ZFLOLXOJZXPIMW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.23 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|