C16H17F17N2O4S — CID 19360943
2-[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)-hexylamino]acetic acid (PubChem CID 19360943) has the molecular formula C16H17F17N2O4S and a molecular weight of 656.35 g/mol. Its IUPAC name is 2-[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)-hexylamino]acetic acid.
| Compound Name | 2-[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)-hexylamino]acetic acid |
|---|---|
| PubChem CID | 19360943 |
| Molecular Formula | C16H17F17N2O4S |
| Molecular Weight | 656.35 g/mol |
| Exact Mass | 656.06 |
| IUPAC Name | 2-[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)-hexylamino]acetic acid |
| SMILES | CCCCCCN(CC(=O)O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H17F17N2O4S/c1-2-3-4-5-6-35(7-8(36)37)34-40(38,39)16(32,33)14(27,28)12(23,24)10(19,20)9(17,18)11(21,22)13(25,26)15(29,30)31/h34H,2-7H2,1H3,(H,36,37) |
| InChIKey | DVNOFPHJOJOABN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.35 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|