C14H14F17N3O3S — CID 87827389
N-[2-(ethylamino)ethyl]-N'-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)acetohydrazide (PubChem CID 87827389) has the molecular formula C14H14F17N3O3S and a molecular weight of 627.32 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-N'-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)acetohydrazide.
| Compound Name | N-[2-(ethylamino)ethyl]-N'-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)acetohydrazide |
|---|---|
| PubChem CID | 87827389 |
| Molecular Formula | C14H14F17N3O3S |
| Molecular Weight | 627.32 g/mol |
| Exact Mass | 627.05 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-N'-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)acetohydrazide |
| SMILES | CCNCCN(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)=O |
| InChI | InChI=1S/C14H14F17N3O3S/c1-3-32-4-5-34(6(2)35)33-38(36,37)14(30,31)12(25,26)10(21,22)8(17,18)7(15,16)9(19,20)11(23,24)13(27,28)29/h32-33H,3-5H2,1-2H3 |
| InChIKey | COJCRIYZASHTLO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|